| MolName | N-(3-chlorophenyl)-4-[(2Z)-2-[(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylidene]hydrazinyl]-3-nitrobenzenesulfonamide |
| MolecularFormula | C26H23N6O5ClS2 |
| Smiles | [O-][N+](c(cc(cc1)S(Nc2cccc(Cl)c2)(=O)=O)c1N/N=C\c1c(-c2ccccc2)nc(N2CCOCC2)s1)=O |
| InChI | InChI=1S/C26H23ClN6O5S2/c27-19-7-4-8-20(15-19)31-40(36,37)21-9-10-22(23(16-21)33(34)35)30-28-17-24-25(18-5-2-1-3-6-18)29-26(39-24)32-11-13-38-14-12-32/h1-10,15-17,30-31H,11-14H2 |
| InChIK | QKTSCFOAGNAPQV-UHFFFAOYSA-N |
| TotalMolweight | 599.091 |
| Molweight | 599.091 |
| MonoisotopicMass | 598.085986 |
| CLogP | 5.9511 |
| CLogS | -7.402 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 424.43 |
| Relative PSA | 0.32587 |
| PolarSurfaceArea | 178.36 |
| Druglikeness | -1.7394 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 40 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 7 |
| Symmetricatoms | 5 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-(3-chlorophenyl)-4-[(2Z)-2-[(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylidene]hydrazinyl]-3-nitrobenzenesulfonamide | 2 - N-(3-chlorophenyl)-4-[(2Z)-2-[(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylidene]hydrazinyl]-3-nitrobenzenesulfonamide