| MolName | 2-(1H-indazol-5-yliminomethyl)-4,6-dinitrophenolate |
| MolecularFormula | C14H8N5O5 |
| Smiles | [O-]c(c(/C=N/c(cc1)cc2c1[nH]nc2)cc([N+]([O-])=O)c1)c1[N+]([O-])=O |
| InChI | InChI=1S/C14H9N5O5/c20-14-9(4-11(18(21)22)5-13(14)19(23)24)6-15-10-1-2-12-8(3-10)7-16-17-12/h1-7,20H,(H,16,17)/p-1 |
| InChIK | QLLDQSUGDVREJS-UHFFFAOYSA-M |
| TotalMolweight | 326.248 |
| Molweight | 326.248 |
| MonoisotopicMass | 326.052545 |
| CLogP | -1.523 |
| CLogS | -3.856 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 235.58 |
| Relative PSA | 0.47368 |
| PolarSurfaceArea | 155.74 |
| Druglikeness | -3.1684 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 3 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-(1H-indazol-5-yliminomethyl)-4,6-dinitrophenolate | 2 - 2-(1H-indazol-5-yliminomethyl)-4,6-dinitrophenolate