| MolName | 2-[N-(benzenesulfonyl)-4-chloroanilino]-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]acetamide |
| MolecularFormula | C21H16N3O3Cl3S |
| Smiles | O=C(CN(c(cc1)ccc1Cl)S(c1ccccc1)(=O)=O)N/N=C\c(c(Cl)ccc1)c1Cl |
| InChI | InChI=1S/C21H16Cl3N3O3S/c22-15-9-11-16(12-10-15)27(31(29,30)17-5-2-1-3-6-17)14-21(28)26-25-13-18-19(23)7-4-8-20(18)24/h1-13H,14H2,(H,26,28) |
| InChIK | QLPQGMCIDXBWNB-UHFFFAOYSA-N |
| TotalMolweight | 496.801 |
| Molweight | 496.801 |
| MonoisotopicMass | 494.997793 |
| CLogP | 4.8688 |
| CLogS | -7.134 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 345.65 |
| Relative PSA | 0.19714 |
| PolarSurfaceArea | 87.22 |
| Druglikeness | 0.28821 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.48387 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 8 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[N-(benzenesulfonyl)-4-chloroanilino]-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]acetamide | 2 - 2-[N-(benzenesulfonyl)-4-chloroanilino]-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]acetamide