| MolName | 2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-N-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]acetamide |
| MolecularFormula | C19H19N5O5BrClS |
| Smiles | [O-][N+](c(cc(/C=N\NC(CN(CC1)CCN1S(c(cc1)ccc1Br)(=O)=O)=O)cc1)c1Cl)=O |
| InChI | InChI=1S/C19H19BrClN5O5S/c20-15-2-4-16(5-3-15)32(30,31)25-9-7-24(8-10-25)13-19(27)23-22-12-14-1-6-17(21)18(11-14)26(28)29/h1-6,11-12H,7-10,13H2,(H,23,27) |
| InChIK | QLQGIDGIEDSHMF-UHFFFAOYSA-N |
| TotalMolweight | 544.813 |
| Molweight | 544.813 |
| MonoisotopicMass | 542.997878 |
| CLogP | 1.4818 |
| CLogS | -4.221 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 349.19 |
| Relative PSA | 0.29242 |
| PolarSurfaceArea | 136.28 |
| Druglikeness | -0.74495 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 8 |
| Symmetricatoms | 5 |
| Amides | 1 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-N-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]acetamide | 2 - 2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-N-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]acetamide