| MolName | N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]acetamide |
| MolecularFormula | C20H20N2O3Cl2 |
| Smiles | CC(N/N=C\c(cc1CC=C)cc(OC)c1OCc(ccc(Cl)c1)c1Cl)=O |
| InChI | InChI=1S/C20H20Cl2N2O3/c1-4-5-15-8-14(11-23-24-13(2)25)9-19(26-3)20(15)27-12-16-6-7-17(21)10-18(16)22/h4,6-11H,1,5,12H2,2-3H3,(H,24,25) |
| InChIK | QLWFFAHTWWRMAK-UHFFFAOYSA-N |
| TotalMolweight | 407.296 |
| Molweight | 407.296 |
| MonoisotopicMass | 406.085097 |
| CLogP | 5.2763 |
| CLogS | -6.094 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 314.41 |
| Relative PSA | 0.17814 |
| PolarSurfaceArea | 59.92 |
| Druglikeness | 0.36799 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.59259 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 8 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]acetamide | 2 - N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]acetamide