| MolName | N-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]benzo[e][1]benzofuran-2-carboxamide |
| MolecularFormula | C24H15N3O5 |
| Smiles | [O-][N+](c(cc1)ccc1-c1ccc(/C=N\NC(c2cc(c3ccccc3cc3)c3o2)=O)o1)=O |
| InChI | InChI=1S/C24H15N3O5/c28-24(23-13-20-19-4-2-1-3-15(19)7-11-22(20)32-23)26-25-14-18-10-12-21(31-18)16-5-8-17(9-6-16)27(29)30/h1-14H,(H,26,28) |
| InChIK | QLZCRJHNRLGRMH-UHFFFAOYSA-N |
| TotalMolweight | 425.399 |
| Molweight | 425.399 |
| MonoisotopicMass | 425.101172 |
| CLogP | 4.9189 |
| CLogS | -8.43 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 319 |
| Relative PSA | 0.29671 |
| PolarSurfaceArea | 113.56 |
| Druglikeness | 1.5725 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]benzo[e][1]benzofuran-2-carboxamide | 2 - N-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]benzo[e][1]benzofuran-2-carboxamide