| MolName | (E)-1-[2-(1,3-benzothiazol-2-ylsulfanyl)-5-nitrophenyl]-N-(1,2,4-triazol-4-yl)methanimine |
| MolecularFormula | C16H10N6O2S2 |
| Smiles | [O-][N+](c(cc1)cc(/C=N/n2cnnc2)c1Sc1nc(cccc2)c2s1)=O |
| InChI | InChI=1S/C16H10N6O2S2/c23-22(24)12-5-6-14(11(7-12)8-19-21-9-17-18-10-21)25-16-20-13-3-1-2-4-15(13)26-16/h1-10H |
| InChIK | QMDNRLGGGJMMGT-UHFFFAOYSA-N |
| TotalMolweight | 382.427 |
| Molweight | 382.427 |
| MonoisotopicMass | 382.030664 |
| CLogP | 2.6297 |
| CLogS | -7.392 |
| H Acceptors | 8 |
| TotalSurfaceArea | 274.72 |
| Relative PSA | 0.43521 |
| PolarSurfaceArea | 155.32 |
| Druglikeness | -1.4409 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 4 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (E)-1-[2-(1,3-benzothiazol-2-ylsulfanyl)-5-nitrophenyl]-N-(1,2,4-triazol-4-yl)methanimine | 2 - (E)-1-[2-(1,3-benzothiazol-2-ylsulfanyl)-5-nitrophenyl]-N-(1,2,4-triazol-4-yl)methanimine