| MolName | 2-[benzyl-(4-bromophenyl)sulfonylamino]-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]acetamide |
| MolecularFormula | C29H26N3O4BrS |
| Smiles | O=C(CN(Cc1ccccc1)S(c(cc1)ccc1Br)(=O)=O)N/N=C\c(cccc1)c1OCc1ccccc1 |
| InChI | InChI=1S/C29H26BrN3O4S/c30-26-15-17-27(18-16-26)38(35,36)33(20-23-9-3-1-4-10-23)21-29(34)32-31-19-25-13-7-8-14-28(25)37-22-24-11-5-2-6-12-24/h1-19H,20-22H2,(H,32,34) |
| InChIK | QMMHEQOUPSRZAH-UHFFFAOYSA-N |
| TotalMolweight | 592.512 |
| Molweight | 592.512 |
| MonoisotopicMass | 591.082738 |
| CLogP | 5.5565 |
| CLogS | -6.12 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 415.3 |
| Relative PSA | 0.18815 |
| PolarSurfaceArea | 96.45 |
| Druglikeness | 0.40547 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.52632 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 10 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 5 |
| Symmetricatoms | 7 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[benzyl-(4-bromophenyl)sulfonylamino]-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]acetamide | 2 - 2-[benzyl-(4-bromophenyl)sulfonylamino]-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]acetamide