2-[2-[(Z)-(benzylcarbamothioylhydrazinylidene)methyl]phenoxy]acetic acid
Formula:C17H17N3O3S
Mutagenic:high
Tumorigenic:none
Reproductive Effective:high
2-[2-[(Z)-(benzylcarbamothioylhydrazinylidene)methyl]phenoxy]acetic acid is a drug-like molecule.
| MolName | 2-[2-[(Z)-(benzylcarbamothioylhydrazinylidene)methyl]phenoxy]acetic acid |
| MolecularFormula | C17H17N3O3S |
| Smiles | OC(COc1c(/C=N\NC(NCc2ccccc2)=S)cccc1)=O |
| InChI | InChI=1S/C17H17N3O3S/c21-16(22)12-23-15-9-5-4-8-14(15)11-19-20-17(24)18-10-13-6-2-1-3-7-13/h1-9,11H,10,12H2,(H,21,22)(H2,18,20,24) |
| InChIK | QMNYZOWTMVUUHI-UHFFFAOYSA-N |
| TotalMolweight | 343.406 |
| Molweight | 343.406 |
| MonoisotopicMass | 343.099062 |
| CLogP | 2.3616 |
| CLogS | -3.93 |
| H Acceptors | 6 |
| H Donors | 3 |
| TotalSurfaceArea | 275.03 |
| Relative PSA | 0.3584 |
| PolarSurfaceArea | 115.04 |
| Druglikeness | 2.7138 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-[(Z)-(benzylcarbamothioylhydrazinylidene)methyl]phenoxy]acetic acid | 2 - 2-[2-[(Z)-(benzylcarbamothioylhydrazinylidene)methyl]phenoxy]acetic acid
Spacefill |
Wire |
Ball & Stick |
Iso-vdw |
Opaque |
Dot Surface |
Mep |
Translucent |
Spin |
Label On |
Off