| MolName | 4-[(Z)-(4-bromophenyl)methylideneamino]spiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-3,5-dione |
| MolecularFormula | C18H15N2O2Br |
| Smiles | O=C(C(C1C2=O)C3C=CC1C31CC1)N2/N=C\c(cc1)ccc1Br |
| InChI | InChI=1S/C18H15BrN2O2/c19-11-3-1-10(2-4-11)9-20-21-16(22)14-12-5-6-13(15(14)17(21)23)18(12)7-8-18/h1-6,9,12-15H,7-8H2 |
| InChIK | QMTDZAVNWVAJSX-UHFFFAOYSA-N |
| TotalMolweight | 371.233 |
| Molweight | 371.233 |
| MonoisotopicMass | 370.031689 |
| CLogP | 2.7713 |
| CLogS | -4.525 |
| H Acceptors | 4 |
| TotalSurfaceArea | 222.88 |
| Relative PSA | 0.18458 |
| PolarSurfaceArea | 49.74 |
| Druglikeness | 3.2791 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | low |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.56522 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| StereoCenters | 4 |
| Rotatable Bond | 2 |
| Rings Closures | 5 |
| Small Rings | 6 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 7 |
| Symmetricatoms | 8 |
| StereoCon | unknown chirality |
Click to Load Molecule:
1 - 4-[(Z)-(4-bromophenyl)methylideneamino]spiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-3,5-dione | 2 - 4-[(Z)-(4-bromophenyl)methylideneamino]spiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-3,5-dione