| MolName | N-[(Z)-[(8Z)-8-[(2,4-dinitrophenyl)hydrazinylidene]octylidene]amino]-2,4-dinitroaniline |
| MolecularFormula | C20H22N8O8 |
| Smiles | [O-][N+](c(cc1)cc([N+]([O-])=O)c1N/N=C\CCCCCC/C=N\Nc(ccc([N+]([O-])=O)c1)c1[N+]([O-])=O)=O |
| InChI | InChI=1S/C20H22N8O8/c29-25(30)15-7-9-17(19(13-15)27(33)34)23-21-11-5-3-1-2-4-6-12-22-24-18-10-8-16(26(31)32)14-20(18)28(35)36/h7-14,23-24H,1-6H2 |
| InChIK | QMZOEMVWUQWERP-UHFFFAOYSA-N |
| TotalMolweight | 502.443 |
| Molweight | 502.443 |
| MonoisotopicMass | 502.156062 |
| CLogP | 4.2352 |
| CLogS | -6.278 |
| H Acceptors | 16 |
| H Donors | 2 |
| TotalSurfaceArea | 382.7 |
| Relative PSA | 0.43799 |
| PolarSurfaceArea | 232.06 |
| Druglikeness | -8.5513 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 16 |
| Electronegative Atoms | 16 |
| Rotatable Bond | 15 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 10 |
| Symmetricatoms | 18 |
| AcidicOxygens | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[(8Z)-8-[(2,4-dinitrophenyl)hydrazinylidene]octylidene]amino]-2,4-dinitroaniline | 2 - N-[(Z)-[(8Z)-8-[(2,4-dinitrophenyl)hydrazinylidene]octylidene]amino]-2,4-dinitroaniline