| MolName | N'-[(Z)-(4-chlorophenyl)methylideneamino]-N-(2-phenylethyl)propanediamide |
| MolecularFormula | C18H18N3O2Cl |
| Smiles | O=C(CC(N/N=C\c(cc1)ccc1Cl)=O)NCCc1ccccc1 |
| InChI | InChI=1S/C18H18ClN3O2/c19-16-8-6-15(7-9-16)13-21-22-18(24)12-17(23)20-11-10-14-4-2-1-3-5-14/h1-9,13H,10-12H2,(H,20,23)(H,22,24) |
| InChIK | QNBHJCQBXDDHAJ-UHFFFAOYSA-N |
| TotalMolweight | 343.813 |
| Molweight | 343.813 |
| MonoisotopicMass | 343.108754 |
| CLogP | 3.3438 |
| CLogS | -4.459 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 272.9 |
| Relative PSA | 0.22173 |
| PolarSurfaceArea | 70.56 |
| Druglikeness | 2.5376 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.75 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N'-[(Z)-(4-chlorophenyl)methylideneamino]-N-(2-phenylethyl)propanediamide | 2 - N'-[(Z)-(4-chlorophenyl)methylideneamino]-N-(2-phenylethyl)propanediamide