| MolName | N-[2-[(2Z)-2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]hydrazinyl]-2-oxoethyl]furan-2-carboxamide |
| MolecularFormula | C18H13N3O4Cl2 |
| Smiles | O=C(CNC(c1ccco1)=O)N/N=C\c1ccc(-c(cc(cc2)Cl)c2Cl)o1 |
| InChI | InChI=1S/C18H13Cl2N3O4/c19-11-3-5-14(20)13(8-11)15-6-4-12(27-15)9-22-23-17(24)10-21-18(25)16-2-1-7-26-16/h1-9H,10H2,(H,21,25)(H,23,24) |
| InChIK | QNFXRHIJHDLKGN-UHFFFAOYSA-N |
| TotalMolweight | 406.224 |
| Molweight | 406.224 |
| MonoisotopicMass | 405.028311 |
| CLogP | 3.6249 |
| CLogS | -6.102 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 299.94 |
| Relative PSA | 0.29583 |
| PolarSurfaceArea | 96.84 |
| Druglikeness | 7.2394 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.62963 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 1 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[2-[(2Z)-2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]hydrazinyl]-2-oxoethyl]furan-2-carboxamide | 2 - N-[2-[(2Z)-2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]hydrazinyl]-2-oxoethyl]furan-2-carboxamide