| MolName | N-[(Z)-(3-nitrophenyl)methylideneamino]-2,6-di(piperidin-1-yl)pyrimidin-4-amine |
| MolecularFormula | C21H27N7O2 |
| Smiles | [O-][N+](c1cc(/C=N\Nc2nc(N3CCCCC3)nc(N3CCCCC3)c2)ccc1)=O |
| InChI | InChI=1S/C21H27N7O2/c29-28(30)18-9-7-8-17(14-18)16-22-25-19-15-20(26-10-3-1-4-11-26)24-21(23-19)27-12-5-2-6-13-27/h7-9,14-16H,1-6,10-13H2,(H,23,24,25) |
| InChIK | QNKCFTFUJMNZLM-UHFFFAOYSA-N |
| TotalMolweight | 409.492 |
| Molweight | 409.492 |
| MonoisotopicMass | 409.222623 |
| CLogP | 4.7536 |
| CLogS | -5.91 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 321.63 |
| Relative PSA | 0.25629 |
| PolarSurfaceArea | 102.47 |
| Druglikeness | -2.5018 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 11 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(3-nitrophenyl)methylideneamino]-2,6-di(piperidin-1-yl)pyrimidin-4-amine | 2 - N-[(Z)-(3-nitrophenyl)methylideneamino]-2,6-di(piperidin-1-yl)pyrimidin-4-amine