| MolName | N-[(Z)-[5-(3-bromophenyl)furan-2-yl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
| MolecularFormula | C20H12N3O4BrS |
| Smiles | [O-][N+](c(cc1)cc2c1sc(C(N/N=C\c1ccc(-c3cccc(Br)c3)o1)=O)c2)=O |
| InChI | InChI=1S/C20H12BrN3O4S/c21-14-3-1-2-12(8-14)17-6-5-16(28-17)11-22-23-20(25)19-10-13-9-15(24(26)27)4-7-18(13)29-19/h1-11H,(H,23,25) |
| InChIK | QNKLZCVYRJHDAI-UHFFFAOYSA-N |
| TotalMolweight | 470.302 |
| Molweight | 470.302 |
| MonoisotopicMass | 468.973188 |
| CLogP | 4.8653 |
| CLogS | -7.824 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 309.28 |
| Relative PSA | 0.32624 |
| PolarSurfaceArea | 128.66 |
| Druglikeness | 0.59406 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.62069 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Sp3Atoms | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(3-bromophenyl)furan-2-yl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide | 2 - N-[(Z)-[5-(3-bromophenyl)furan-2-yl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide