| MolName | N-[(Z)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]-2-hydroxyacetamide |
| MolecularFormula | C13H11N2O3Cl |
| Smiles | OCC(N/N=C\c1ccc(-c2cccc(Cl)c2)o1)=O |
| InChI | InChI=1S/C13H11ClN2O3/c14-10-3-1-2-9(6-10)12-5-4-11(19-12)7-15-16-13(18)8-17/h1-7,17H,8H2,(H,16,18) |
| InChIK | QNOQNUPQPMMVDH-UHFFFAOYSA-N |
| TotalMolweight | 278.694 |
| Molweight | 278.694 |
| MonoisotopicMass | 278.04582 |
| CLogP | 2.376 |
| CLogS | -4.24 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 212.21 |
| Relative PSA | 0.29791 |
| PolarSurfaceArea | 74.83 |
| Druglikeness | 6.7421 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68421 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]-2-hydroxyacetamide | 2 - N-[(Z)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]-2-hydroxyacetamide