| MolName | N-[(Z)-[1-(naphthalen-1-ylmethyl)indol-3-yl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
| MolecularFormula | C33H36N8 |
| Smiles | C(c1cccc2ccccc12)n1c(cccc2)c2c(/C=N\Nc2nc(N3CCCCC3)nc(N3CCCCC3)n2)c1 |
| InChI | InChI=1S/C33H36N8/c1-7-18-39(19-8-1)32-35-31(36-33(37-32)40-20-9-2-10-21-40)38-34-22-27-24-41(30-17-6-5-16-29(27)30)23-26-14-11-13-25-12-3-4-15-28(25)26/h3-6,11-17,22,24H,1-2,7-10,18-21,23H2,(H,35,36,37,38) |
| InChIK | QNOQXXSQSYILOY-UHFFFAOYSA-N |
| TotalMolweight | 544.705 |
| Molweight | 544.705 |
| MonoisotopicMass | 544.306292 |
| CLogP | 8.6526 |
| CLogS | -7.903 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 428.64 |
| Relative PSA | 0.16296 |
| PolarSurfaceArea | 74.47 |
| Druglikeness | 3.0204 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.46341 |
| Fragments | 1 |
| Non HAtoms | 41 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 7 |
| Small Rings | 7 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 25 |
| Sp3Atoms | 11 |
| Symmetricatoms | 10 |
| Aromatic Nitrogens | 4 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[1-(naphthalen-1-ylmethyl)indol-3-yl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine | 2 - N-[(Z)-[1-(naphthalen-1-ylmethyl)indol-3-yl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine