| MolName | 1-(3,4-dichlorophenyl)-3-[(Z)-(2,6-difluorophenyl)methylideneamino]thiourea |
| MolecularFormula | C14H9N3Cl2F2S |
| Smiles | Fc1cccc(F)c1/C=N\NC(Nc(cc1)cc(Cl)c1Cl)=S |
| InChI | InChI=1S/C14H9Cl2F2N3S/c15-10-5-4-8(6-11(10)16)20-14(22)21-19-7-9-12(17)2-1-3-13(9)18/h1-7H,(H2,20,21,22) |
| InChIK | QODODPOYCOJYPS-UHFFFAOYSA-N |
| TotalMolweight | 360.214 |
| Molweight | 360.214 |
| MonoisotopicMass | 358.986227 |
| CLogP | 5.0058 |
| CLogS | -6.421 |
| H Acceptors | 3 |
| H Donors | 2 |
| TotalSurfaceArea | 256.95 |
| Relative PSA | 0.24297 |
| PolarSurfaceArea | 68.51 |
| Druglikeness | 0.92359 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.63636 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 1 |
| Symmetricatoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - 1-(3,4-dichlorophenyl)-3-[(Z)-(2,6-difluorophenyl)methylideneamino]thiourea | 2 - 1-(3,4-dichlorophenyl)-3-[(Z)-(2,6-difluorophenyl)methylideneamino]thiourea