| MolName | 5-N-[(Z)-(4-fluorophenyl)methylideneamino]-9H-[1,2,4]triazolo[1,5-d][1,2,4]triazepine-5,8-diamine |
| MolecularFormula | C12H11N8F |
| Smiles | NC1=NN=C(N/N=C\c(cc2)ccc2F)n2ncnc2C1 |
| InChI | InChI=1S/C12H11FN8/c13-9-3-1-8(2-4-9)6-16-19-12-20-18-10(14)5-11-15-7-17-21(11)12/h1-4,6-7H,5H2,(H2,14,18)(H,19,20) |
| InChIK | QOIASOKYWVTUKV-UHFFFAOYSA-N |
| TotalMolweight | 286.273 |
| Molweight | 286.273 |
| MonoisotopicMass | 286.10907 |
| CLogP | 2.1267 |
| CLogS | -3.929 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 217.03 |
| Relative PSA | 0.41501 |
| PolarSurfaceArea | 105.84 |
| Druglikeness | 3.2585 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.61905 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 2 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 5-N-[(Z)-(4-fluorophenyl)methylideneamino]-9H-[1,2,4]triazolo[1,5-d][1,2,4]triazepine-5,8-diamine | 2 - 5-N-[(Z)-(4-fluorophenyl)methylideneamino]-9H-[1,2,4]triazolo[1,5-d][1,2,4]triazepine-5,8-diamine