| MolName | 2-[[5-(4-bromophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(4-ethoxyphenyl)methylideneamino]acetamide |
| MolecularFormula | C25H22N5O2BrS |
| Smiles | CCOc1ccc(C=NNC(CSc2nnc(-c(cc3)ccc3Br)n2-c2ccccc2)=O)cc1 |
| InChI | InChI=1S/C25H22BrN5O2S/c1-2-33-22-14-8-18(9-15-22)16-27-28-23(32)17-34-25-30-29-24(19-10-12-20(26)13-11-19)31(25)21-6-4-3-5-7-21/h3-16H,2,17H2,1H3,(H,28,32) |
| InChIK | QOKDQBBAMZPJIC-UHFFFAOYSA-N |
| TotalMolweight | 536.453 |
| Molweight | 536.453 |
| MonoisotopicMass | 535.067756 |
| CLogP | 5.5933 |
| CLogS | -9.568 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 379.13 |
| Relative PSA | 0.24348 |
| PolarSurfaceArea | 106.7 |
| Druglikeness | 2.1027 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.61765 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 5 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-[[5-(4-bromophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(4-ethoxyphenyl)methylideneamino]acetamide | 2 - 2-[[5-(4-bromophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(4-ethoxyphenyl)methylideneamino]acetamide