| MolName | N-[(Z)-cyclohexylmethylideneamino]-4-phenylbenzamide |
| MolecularFormula | C20H22N2O |
| Smiles | O=C(c(cc1)ccc1-c1ccccc1)N/N=C\C1CCCCC1 |
| InChI | InChI=1S/C20H22N2O/c23-20(22-21-15-16-7-3-1-4-8-16)19-13-11-18(12-14-19)17-9-5-2-6-10-17/h2,5-6,9-16H,1,3-4,7-8H2,(H,22,23) |
| InChIK | QOLJDSSHYHILDX-UHFFFAOYSA-N |
| TotalMolweight | 306.408 |
| Molweight | 306.408 |
| MonoisotopicMass | 306.173213 |
| CLogP | 4.4502 |
| CLogS | -5.885 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 254.79 |
| Relative PSA | 0.14133 |
| PolarSurfaceArea | 41.46 |
| Druglikeness | -0.46332 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.69565 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 3 |
| Electronegative Atoms | 3 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 6 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-cyclohexylmethylideneamino]-4-phenylbenzamide | 2 - N-[(Z)-cyclohexylmethylideneamino]-4-phenylbenzamide