| MolName | 6-amino-N-[(Z)-quinoxalin-5-ylmethylideneamino]hexanamide |
| MolecularFormula | C15H19N5O |
| Smiles | NCCCCCC(N/N=C\c1cccc2nccnc12)=O |
| InChI | InChI=1S/C15H19N5O/c16-8-3-1-2-7-14(21)20-19-11-12-5-4-6-13-15(12)18-10-9-17-13/h4-6,9-11H,1-3,7-8,16H2,(H,20,21) |
| InChIK | QOLYJAPLRZSFNQ-UHFFFAOYSA-N |
| TotalMolweight | 285.35 |
| Molweight | 285.35 |
| MonoisotopicMass | 285.15896 |
| CLogP | 1.6885 |
| CLogS | -3.006 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 236.67 |
| Relative PSA | 0.30938 |
| PolarSurfaceArea | 93.26 |
| Druglikeness | -6.9793 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.71429 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 6 |
| Amines | 1 |
| AlkylAmines | 1 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 6-amino-N-[(Z)-quinoxalin-5-ylmethylideneamino]hexanamide | 2 - 6-amino-N-[(Z)-quinoxalin-5-ylmethylideneamino]hexanamide