| MolName | 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(Z)-(4-oxochromen-3-yl)methylideneamino]acetamide |
| MolecularFormula | C26H19N5O3S |
| Smiles | O=C(CSc1nnc(-c2ccccc2)n1-c1ccccc1)N/N=C\C1=COc(cccc2)c2C1=O |
| InChI | InChI=1S/C26H19N5O3S/c32-23(28-27-15-19-16-34-22-14-8-7-13-21(22)24(19)33)17-35-26-30-29-25(18-9-3-1-4-10-18)31(26)20-11-5-2-6-12-20/h1-16H,17H2,(H,28,32) |
| InChIK | QORCBNZQJHKPMU-UHFFFAOYSA-N |
| TotalMolweight | 481.535 |
| Molweight | 481.535 |
| MonoisotopicMass | 481.12086 |
| CLogP | 3.6492 |
| CLogS | -8.966 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 363.44 |
| Relative PSA | 0.28987 |
| PolarSurfaceArea | 123.77 |
| Druglikeness | 5.9799 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | twice activated DB; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54286 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(Z)-(4-oxochromen-3-yl)methylideneamino]acetamide | 2 - 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(Z)-(4-oxochromen-3-yl)methylideneamino]acetamide