| MolName | N,N'-bis[(Z)-naphthalen-1-ylmethylideneamino]decanediamide |
| MolecularFormula | C32H34N4O2 |
| Smiles | O=C(CCCCCCCCC(N/N=C\c1cccc2ccccc12)=O)N/N=C\c1cccc2ccccc12 |
| InChI | InChI=1S/C32H34N4O2/c37-31(35-33-23-27-17-11-15-25-13-7-9-19-29(25)27)21-5-3-1-2-4-6-22-32(38)36-34-24-28-18-12-16-26-14-8-10-20-30(26)28/h7-20,23-24H,1-6,21-22H2,(H,35,37)(H,36,38) |
| InChIK | QOXULTXUMQBZSL-UHFFFAOYSA-N |
| TotalMolweight | 506.648 |
| Molweight | 506.648 |
| MonoisotopicMass | 506.268176 |
| CLogP | 8.5624 |
| CLogS | -9.49 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 420.24 |
| Relative PSA | 0.17138 |
| PolarSurfaceArea | 82.92 |
| Druglikeness | -4.1295 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68421 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 13 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Sp3Atoms | 8 |
| Symmetricatoms | 19 |
| StereoCon |
Click to Load Molecule:
1 - N,N'-bis[(Z)-naphthalen-1-ylmethylideneamino]decanediamide | 2 - N,N'-bis[(Z)-naphthalen-1-ylmethylideneamino]decanediamide