| MolName | 5-[(Z)-[(2-hydroxy-2,2-diphenylacetyl)hydrazinylidene]methyl]furan-2-sulfonic acid |
| MolecularFormula | C19H16N2O6S |
| Smiles | OC(C(N/N=C\c(o1)ccc1S(O)(=O)=O)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H16N2O6S/c22-18(21-20-13-16-11-12-17(27-16)28(24,25)26)19(23,14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-13,23H,(H,21,22)(H,24,25,26) |
| InChIK | QOXXYKBFCSCITI-UHFFFAOYSA-N |
| TotalMolweight | 400.41 |
| Molweight | 400.41 |
| MonoisotopicMass | 400.072908 |
| CLogP | 0.5387 |
| CLogS | -2.478 |
| H Acceptors | 8 |
| H Donors | 3 |
| TotalSurfaceArea | 288.13 |
| Relative PSA | 0.36407 |
| PolarSurfaceArea | 137.58 |
| Druglikeness | 9.8851 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 4 |
| Symmetricatoms | 9 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 5-[(Z)-[(2-hydroxy-2,2-diphenylacetyl)hydrazinylidene]methyl]furan-2-sulfonic acid | 2 - 5-[(Z)-[(2-hydroxy-2,2-diphenylacetyl)hydrazinylidene]methyl]furan-2-sulfonic acid