| MolName | 2-N-[(Z)-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine |
| MolecularFormula | C29H22N7OBrCl2 |
| Smiles | Clc1cc(Cl)c(COc(cc2)c(/C=N\Nc3nc(Nc4ccccc4)nc(Nc4ccccc4)n3)cc2Br)cc1 |
| InChI | InChI=1S/C29H22BrCl2N7O/c30-21-12-14-26(40-18-19-11-13-22(31)16-25(19)32)20(15-21)17-33-39-29-37-27(34-23-7-3-1-4-8-23)36-28(38-29)35-24-9-5-2-6-10-24/h1-17H,18H2,(H3,34,35,36,37,38,39) |
| InChIK | QPBSHGWNSSSRHW-UHFFFAOYSA-N |
| TotalMolweight | 635.352 |
| Molweight | 635.352 |
| MonoisotopicMass | 633.044623 |
| CLogP | 10.609 |
| CLogS | -10.138 |
| H Acceptors | 8 |
| H Donors | 3 |
| TotalSurfaceArea | 440.95 |
| Relative PSA | 0.20138 |
| PolarSurfaceArea | 96.35 |
| Druglikeness | 0.070985 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 40 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 10 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 30 |
| Sp3Atoms | 2 |
| Symmetricatoms | 11 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-N-[(Z)-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine | 2 - 2-N-[(Z)-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine