| MolName | N-(furan-2-ylmethyl)-N'-[(Z)-thiophen-2-ylmethylideneamino]oxamide |
| MolecularFormula | C12H11N3O3S |
| Smiles | O=C(C(N/N=C\c1cccs1)=O)NCc1ccco1 |
| InChI | InChI=1S/C12H11N3O3S/c16-11(13-7-9-3-1-5-18-9)12(17)15-14-8-10-4-2-6-19-10/h1-6,8H,7H2,(H,13,16)(H,15,17) |
| InChIK | QPCDSDXPEBGCBP-UHFFFAOYSA-N |
| TotalMolweight | 277.303 |
| Molweight | 277.303 |
| MonoisotopicMass | 277.052112 |
| CLogP | 0.9086 |
| CLogS | -3.033 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 215.59 |
| Relative PSA | 0.44056 |
| PolarSurfaceArea | 111.94 |
| Druglikeness | 5.0898 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.68421 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 1 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-(furan-2-ylmethyl)-N'-[(Z)-thiophen-2-ylmethylideneamino]oxamide | 2 - N-(furan-2-ylmethyl)-N'-[(Z)-thiophen-2-ylmethylideneamino]oxamide