| MolName | 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-N-[(Z)-(4-nitrophenyl)methylideneamino]heptanamide |
| MolecularFormula | C14H6N3O3F13 |
| Smiles | [O-][N+](c1ccc(/C=N\NC(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)=O)cc1)=O |
| InChI | InChI=1S/C14H6F13N3O3/c15-9(16,8(31)29-28-5-6-1-3-7(4-2-6)30(32)33)10(17,18)11(19,20)12(21,22)13(23,24)14(25,26)27/h1-5H,(H,29,31) |
| InChIK | QPJPZZIYRQWGNT-UHFFFAOYSA-N |
| TotalMolweight | 511.194 |
| Molweight | 511.194 |
| MonoisotopicMass | 511.020156 |
| CLogP | 4.8655 |
| CLogS | -7.341 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 295.91 |
| Relative PSA | 0.22449 |
| PolarSurfaceArea | 87.28 |
| Druglikeness | -117.54 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51515 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 19 |
| Electronegative Atoms | 19 |
| Rotatable Bond | 9 |
| Rings Closures | 1 |
| Small Rings | 1 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 7 |
| Symmetricatoms | 9 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-N-[(Z)-(4-nitrophenyl)methylideneamino]heptanamide | 2 - 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-N-[(Z)-(4-nitrophenyl)methylideneamino]heptanamide