| MolName | (Z)-N-carbazol-9-yl-1-[4-[(Z)-carbazol-9-yliminomethyl]phenyl]methanimine |
| MolecularFormula | C32H22N4 |
| Smiles | C(c1ccc(/C=N\n2c(cccc3)c3c3c2cccc3)cc1)=N\n1c(cccc2)c2c2c1cccc2 |
| InChI | InChI=1S/C32H22N4/c1-5-13-29-25(9-1)26-10-2-6-14-30(26)35(29)33-21-23-17-19-24(20-18-23)22-34-36-31-15-7-3-11-27(31)28-12-4-8-16-32(28)36/h1-22H |
| InChIK | QPNVJLSKXMOZLW-UHFFFAOYSA-N |
| TotalMolweight | 462.555 |
| Molweight | 462.555 |
| MonoisotopicMass | 462.184446 |
| CLogP | 7.9698 |
| CLogS | -13.156 |
| H Acceptors | 4 |
| TotalSurfaceArea | 359.1 |
| Relative PSA | 0.10237 |
| PolarSurfaceArea | 34.58 |
| Druglikeness | 3.4029 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 4 |
| Rings Closures | 7 |
| Small Rings | 7 |
| Aromatic Rings | 7 |
| Aromatic Atoms | 32 |
| Symmetricatoms | 25 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-carbazol-9-yl-1-[4-[(Z)-carbazol-9-yliminomethyl]phenyl]methanimine | 2 - (Z)-N-carbazol-9-yl-1-[4-[(Z)-carbazol-9-yliminomethyl]phenyl]methanimine