| MolName | (8S)-6-[(Z)-(3-phenoxyphenyl)methylideneamino]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| MolecularFormula | C27H22N4O3 |
| Smiles | O=C(CN1/N=C\c2cc(Oc3ccccc3)ccc2)N(Cc2c(C3)c(cccc4)c4[nH]2)[C@@H]3C1=O |
| InChI | InChI=1S/C27H22N4O3/c32-26-17-31(28-15-18-7-6-10-20(13-18)34-19-8-2-1-3-9-19)27(33)25-14-22-21-11-4-5-12-23(21)29-24(22)16-30(25)26/h1-13,15,25,29H,14,16-17H2/t25-/m0/s1 |
| InChIK | QPOLKXBOBXYNAW-VWLOTQADSA-N |
| TotalMolweight | 450.497 |
| Molweight | 450.497 |
| MonoisotopicMass | 450.169191 |
| CLogP | 3.2101 |
| CLogS | -5.893 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 334.59 |
| Relative PSA | 0.20527 |
| PolarSurfaceArea | 78 |
| Druglikeness | 7.4434 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.55882 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| StereoCenters | 1 |
| Rotatable Bond | 4 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - (8S)-6-[(Z)-(3-phenoxyphenyl)methylideneamino]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione | 2 - (8S)-6-[(Z)-(3-phenoxyphenyl)methylideneamino]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione