| MolName | N'-[(Z)-(4-fluorophenyl)methylideneamino]-N-pyridin-2-yloxamide |
| MolecularFormula | C14H11N4O2F |
| Smiles | O=C(C(N/N=C\c(cc1)ccc1F)=O)Nc1ncccc1 |
| InChI | InChI=1S/C14H11FN4O2/c15-11-6-4-10(5-7-11)9-17-19-14(21)13(20)18-12-3-1-2-8-16-12/h1-9H,(H,19,21)(H,16,18,20) |
| InChIK | QQFVABNQOBPIGO-UHFFFAOYSA-N |
| TotalMolweight | 286.265 |
| Molweight | 286.265 |
| MonoisotopicMass | 286.086604 |
| CLogP | 1.5952 |
| CLogS | -3.569 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 221.31 |
| Relative PSA | 0.32299 |
| PolarSurfaceArea | 83.45 |
| Druglikeness | 2.4078 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.71429 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N'-[(Z)-(4-fluorophenyl)methylideneamino]-N-pyridin-2-yloxamide | 2 - N'-[(Z)-(4-fluorophenyl)methylideneamino]-N-pyridin-2-yloxamide