| MolName | 3-cyclohexyl-2-[(2Z)-2-(pyridin-4-ylmethylidene)hydrazinyl]spiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-one |
| MolecularFormula | C29H33N5O |
| Smiles | O=C1N(C2CCCCC2)C(N/N=C\c2ccncc2)=NC2=C1C1(CCCCC1)Cc1c2cccc1 |
| InChI | InChI=1S/C29H33N5O/c35-27-25-26(24-12-6-5-9-22(24)19-29(25)15-7-2-8-16-29)32-28(34(27)23-10-3-1-4-11-23)33-31-20-21-13-17-30-18-14-21/h5-6,9,12-14,17-18,20,23H,1-4,7-8,10-11,15-16,19H2,(H,32,33) |
| InChIK | QQHGNNCSTPBTEG-UHFFFAOYSA-N |
| TotalMolweight | 467.615 |
| Molweight | 467.615 |
| MonoisotopicMass | 467.26851 |
| CLogP | 5.5571 |
| CLogS | -6.587 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 362.21 |
| Relative PSA | 0.17128 |
| PolarSurfaceArea | 69.95 |
| Druglikeness | 0.92954 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.42857 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 13 |
| Symmetricatoms | 6 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-cyclohexyl-2-[(2Z)-2-(pyridin-4-ylmethylidene)hydrazinyl]spiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-one | 2 - 3-cyclohexyl-2-[(2Z)-2-(pyridin-4-ylmethylidene)hydrazinyl]spiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-one