| MolName | N-[(Z)-[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylideneamino]-2-(2-nitrophenyl)acetamide |
| MolecularFormula | C19H13N4O6Cl |
| Smiles | [O-][N+](c1c(CC(N/N=C\c2ccc(-c(cc3)cc([N+]([O-])=O)c3Cl)o2)=O)cccc1)=O |
| InChI | InChI=1S/C19H13ClN4O6/c20-15-7-5-13(9-17(15)24(28)29)18-8-6-14(30-18)11-21-22-19(25)10-12-3-1-2-4-16(12)23(26)27/h1-9,11H,10H2,(H,22,25) |
| InChIK | QSISPRZABPRNSA-UHFFFAOYSA-N |
| TotalMolweight | 428.787 |
| Molweight | 428.787 |
| MonoisotopicMass | 428.052363 |
| CLogP | 2.9014 |
| CLogS | -6.802 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 312.96 |
| Relative PSA | 0.35455 |
| PolarSurfaceArea | 146.24 |
| Druglikeness | 1.4324 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.56667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylideneamino]-2-(2-nitrophenyl)acetamide | 2 - N-[(Z)-[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylideneamino]-2-(2-nitrophenyl)acetamide