| MolName | 2-N-[(Z)-naphthalen-2-ylmethylideneamino]-4-N-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C25H25N7 |
| Smiles | C(CC1)CCN1c1nc(N/N=C\c2cc3ccccc3cc2)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C25H25N7/c1-3-11-22(12-4-1)27-23-28-24(30-25(29-23)32-15-7-2-8-16-32)31-26-18-19-13-14-20-9-5-6-10-21(20)17-19/h1,3-6,9-14,17-18H,2,7-8,15-16H2,(H2,27,28,29,30,31) |
| InChIK | QSXYOIPBHGLPBX-UHFFFAOYSA-N |
| TotalMolweight | 423.522 |
| Molweight | 423.522 |
| MonoisotopicMass | 423.217143 |
| CLogP | 7.8203 |
| CLogS | -7.511 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 336.94 |
| Relative PSA | 0.21039 |
| PolarSurfaceArea | 78.33 |
| Druglikeness | 2.9678 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.53125 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-N-[(Z)-naphthalen-2-ylmethylideneamino]-4-N-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine | 2 - 2-N-[(Z)-naphthalen-2-ylmethylideneamino]-4-N-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine