| MolName | [2,4-dibromo-6-[(Z)-[[2-[(4-chlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
| MolecularFormula | C21H14N3O5Br2Cl |
| Smiles | O=C(CNC(c(cc1)ccc1Cl)=O)N/N=C\c1cc(Br)cc(Br)c1OC(c1ccco1)=O |
| InChI | InChI=1S/C21H14Br2ClN3O5/c22-14-8-13(19(16(23)9-14)32-21(30)17-2-1-7-31-17)10-26-27-18(28)11-25-20(29)12-3-5-15(24)6-4-12/h1-10H,11H2,(H,25,29)(H,27,28) |
| InChIK | QSZOXLNKMGPTHN-UHFFFAOYSA-N |
| TotalMolweight | 583.619 |
| Molweight | 583.619 |
| MonoisotopicMass | 580.898871 |
| CLogP | 4.9609 |
| CLogS | -7.044 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 359.84 |
| Relative PSA | 0.2714 |
| PolarSurfaceArea | 110 |
| Druglikeness | 3.5868 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.59375 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [2,4-dibromo-6-[(Z)-[[2-[(4-chlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate | 2 - [2,4-dibromo-6-[(Z)-[[2-[(4-chlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate