| MolName | N-[(Z)-[2,4-bis(difluoromethoxy)phenyl]methylideneamino]-2-[(2-chlorophenyl)methoxy]benzamide |
| MolecularFormula | C23H17N2O4ClF4 |
| Smiles | O=C(c(cccc1)c1OCc(cccc1)c1Cl)N/N=C\c(ccc(OC(F)F)c1)c1OC(F)F |
| InChI | InChI=1S/C23H17ClF4N2O4/c24-18-7-3-1-5-15(18)13-32-19-8-4-2-6-17(19)21(31)30-29-12-14-9-10-16(33-22(25)26)11-20(14)34-23(27)28/h1-12,22-23H,13H2,(H,30,31) |
| InChIK | QTOFLERVGSIKFT-UHFFFAOYSA-N |
| TotalMolweight | 496.843 |
| Molweight | 496.843 |
| MonoisotopicMass | 496.081297 |
| CLogP | 5.4945 |
| CLogS | -7.042 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 356.33 |
| Relative PSA | 0.18525 |
| PolarSurfaceArea | 69.15 |
| Druglikeness | 1.2667 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55882 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 10 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 6 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[2,4-bis(difluoromethoxy)phenyl]methylideneamino]-2-[(2-chlorophenyl)methoxy]benzamide | 2 - N-[(Z)-[2,4-bis(difluoromethoxy)phenyl]methylideneamino]-2-[(2-chlorophenyl)methoxy]benzamide