| MolName | (Z)-N-[(Z)-[2,4-bis(difluoromethoxy)phenyl]methylideneamino]-1,1-diphenylmethanimine |
| MolecularFormula | C22H16N2O2F4 |
| Smiles | FC(Oc1cc(OC(F)F)c(/C=N\N=C(c2ccccc2)c2ccccc2)cc1)F |
| InChI | InChI=1S/C22H16F4N2O2/c23-21(24)29-18-12-11-17(19(13-18)30-22(25)26)14-27-28-20(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-14,21-22H |
| InChIK | QTPRXSBHDNSXMX-UHFFFAOYSA-N |
| TotalMolweight | 416.373 |
| Molweight | 416.373 |
| MonoisotopicMass | 416.11479 |
| CLogP | 6.3211 |
| CLogS | -7.152 |
| H Acceptors | 4 |
| TotalSurfaceArea | 310.91 |
| Relative PSA | 0.13837 |
| PolarSurfaceArea | 43.18 |
| Druglikeness | -1.0997 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 4 |
| Symmetricatoms | 10 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-[(Z)-[2,4-bis(difluoromethoxy)phenyl]methylideneamino]-1,1-diphenylmethanimine | 2 - (Z)-N-[(Z)-[2,4-bis(difluoromethoxy)phenyl]methylideneamino]-1,1-diphenylmethanimine