| MolName | (5Z)-5-[(Z)-2-chloro-3-(4-nitrophenyl)prop-2-enylidene]-3-[(Z)-[(Z)-2-chloro-3-(4-nitrophenyl)prop-2-enylidene]amino]-2-sulfanylidene-1,3-thiazolidin-4-one |
| MolecularFormula | C21H12N4O5Cl2S2 |
| Smiles | [O-][N+](c1ccc(/C=C(/C=C(/C(N2/N=C\C(\Cl)=C\c(cc3)ccc3[N+]([O-])=O)=O)\SC2=S)\Cl)cc1)=O |
| InChI | InChI=1S/C21H12Cl2N4O5S2/c22-15(9-13-1-5-17(6-2-13)26(29)30)11-19-20(28)25(21(33)34-19)24-12-16(23)10-14-3-7-18(8-4-14)27(31)32/h1-12H |
| InChIK | QTVRVYOIJCBWHF-UHFFFAOYSA-N |
| TotalMolweight | 535.387 |
| Molweight | 535.387 |
| MonoisotopicMass | 533.962615 |
| CLogP | 2.8101 |
| CLogS | -8.001 |
| H Acceptors | 9 |
| TotalSurfaceArea | 374.84 |
| Relative PSA | 0.35863 |
| PolarSurfaceArea | 181.7 |
| Druglikeness | -0.1791 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | allyl/benzyl chloride; aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.64706 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - (5Z)-5-[(Z)-2-chloro-3-(4-nitrophenyl)prop-2-enylidene]-3-[(Z)-[(Z)-2-chloro-3-(4-nitrophenyl)prop-2-enylidene]amino]-2-sulfanylidene-1,3-thiazolidin-4-one | 2 - (5Z)-5-[(Z)-2-chloro-3-(4-nitrophenyl)prop-2-enylidene]-3-[(Z)-[(Z)-2-chloro-3-(4-nitrophenyl)prop-2-enylidene]amino]-2-sulfanylidene-1,3-thiazolidin-4-one