| MolName | 3-[(Z)-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylhydrazinylidene)methyl]phenol |
| MolecularFormula | C17H16N4OS |
| Smiles | Oc1cccc(/C=N\Nc2c(c(CCCC3)c3s3)c3ncn2)c1 |
| InChI | InChI=1S/C17H16N4OS/c22-12-5-3-4-11(8-12)9-20-21-16-15-13-6-1-2-7-14(13)23-17(15)19-10-18-16/h3-5,8-10,22H,1-2,6-7H2,(H,18,19,21) |
| InChIK | QUEGIWVIZDVOPL-UHFFFAOYSA-N |
| TotalMolweight | 324.407 |
| Molweight | 324.407 |
| MonoisotopicMass | 324.104481 |
| CLogP | 5.5578 |
| CLogS | -5.542 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 245.19 |
| Relative PSA | 0.31963 |
| PolarSurfaceArea | 98.64 |
| Druglikeness | -1.4453 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.56522 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 5 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylhydrazinylidene)methyl]phenol | 2 - 3-[(Z)-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylhydrazinylidene)methyl]phenol