| MolName | [4-[(Z)-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenyl] benzenesulfonate |
| MolecularFormula | C22H16N3O3BrS2 |
| Smiles | O=S(c1ccccc1)(Oc1ccc(/C=N\Nc2nc(-c(cc3)ccc3Br)cs2)cc1)=O |
| InChI | InChI=1S/C22H16BrN3O3S2/c23-18-10-8-17(9-11-18)21-15-30-22(25-21)26-24-14-16-6-12-19(13-7-16)29-31(27,28)20-4-2-1-3-5-20/h1-15H,(H,25,26) |
| InChIK | QULTXEMEIPHHEP-UHFFFAOYSA-N |
| TotalMolweight | 514.423 |
| Molweight | 514.423 |
| MonoisotopicMass | 512.981643 |
| CLogP | 7.8205 |
| CLogS | -6.268 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 340.67 |
| Relative PSA | 0.27264 |
| PolarSurfaceArea | 117.27 |
| Druglikeness | -3.4112 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.67742 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 2 |
| Symmetricatoms | 7 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenyl] benzenesulfonate | 2 - [4-[(Z)-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenyl] benzenesulfonate