| MolName | N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-3-pyrrolidin-1-ylsulfonylbenzamide |
| MolecularFormula | C20H20N4O5S |
| Smiles | [O-][N+](c1c(/C=C/C=N\NC(c2cccc(S(N3CCCC3)(=O)=O)c2)=O)cccc1)=O |
| InChI | InChI=1S/C20H20N4O5S/c25-20(22-21-12-6-9-16-7-1-2-11-19(16)24(26)27)17-8-5-10-18(15-17)30(28,29)23-13-3-4-14-23/h1-2,5-12,15H,3-4,13-14H2,(H,22,25) |
| InChIK | QUSKQHWRTDHBDI-UHFFFAOYSA-N |
| TotalMolweight | 428.468 |
| Molweight | 428.468 |
| MonoisotopicMass | 428.115441 |
| CLogP | 2.1631 |
| CLogS | -4.298 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 317.58 |
| Relative PSA | 0.31035 |
| PolarSurfaceArea | 133.04 |
| Druglikeness | -6.0418 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.56667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 6 |
| Symmetricatoms | 3 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-3-pyrrolidin-1-ylsulfonylbenzamide | 2 - N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-3-pyrrolidin-1-ylsulfonylbenzamide