| MolName | (2E)-2-[(Z)-[4-(difluoromethoxy)phenyl]methylidenehydrazinylidene]-1,2-diphenylethanone |
| MolecularFormula | C22H16N2O2F2 |
| Smiles | O=C(/C(/c1ccccc1)=N/N=C\c(cc1)ccc1OC(F)F)c1ccccc1 |
| InChI | InChI=1S/C22H16F2N2O2/c23-22(24)28-19-13-11-16(12-14-19)15-25-26-20(17-7-3-1-4-8-17)21(27)18-9-5-2-6-10-18/h1-15,22H |
| InChIK | QVGXHBVTZWUBKC-UHFFFAOYSA-N |
| TotalMolweight | 378.377 |
| Molweight | 378.377 |
| MonoisotopicMass | 378.117984 |
| CLogP | 5.4465 |
| CLogS | -6.43 |
| H Acceptors | 4 |
| TotalSurfaceArea | 293.46 |
| Relative PSA | 0.15695 |
| PolarSurfaceArea | 51.02 |
| Druglikeness | -0.079484 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 7 |
| StereoCon |
Click to Load Molecule:
1 - (2E)-2-[(Z)-[4-(difluoromethoxy)phenyl]methylidenehydrazinylidene]-1,2-diphenylethanone | 2 - (2E)-2-[(Z)-[4-(difluoromethoxy)phenyl]methylidenehydrazinylidene]-1,2-diphenylethanone