| MolName | [2-[(Z)-[[2-(5-amino-1,3,4-thiadiazol-2-yl)acetyl]hydrazinylidene]methyl]phenyl] benzenesulfonate |
| MolecularFormula | C17H15N5O4S2 |
| Smiles | Nc1nnc(CC(N/N=C\c(cccc2)c2OS(c2ccccc2)(=O)=O)=O)s1 |
| InChI | InChI=1S/C17H15N5O4S2/c18-17-22-21-16(27-17)10-15(23)20-19-11-12-6-4-5-9-14(12)26-28(24,25)13-7-2-1-3-8-13/h1-9,11H,10H2,(H2,18,22)(H,20,23) |
| InChIK | QVNXHSACWRAUJE-UHFFFAOYSA-N |
| TotalMolweight | 417.469 |
| Molweight | 417.469 |
| MonoisotopicMass | 417.056545 |
| CLogP | 2.2443 |
| CLogS | -3.743 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 301.07 |
| Relative PSA | 0.43897 |
| PolarSurfaceArea | 173.25 |
| Druglikeness | 0.53876 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.60714 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| Symmetricatoms | 3 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - [2-[(Z)-[[2-(5-amino-1,3,4-thiadiazol-2-yl)acetyl]hydrazinylidene]methyl]phenyl] benzenesulfonate | 2 - [2-[(Z)-[[2-(5-amino-1,3,4-thiadiazol-2-yl)acetyl]hydrazinylidene]methyl]phenyl] benzenesulfonate