| MolName | 3-carbazol-9-yl-N-[(Z)-(3-hydroxyphenyl)methylideneamino]propanamide |
| MolecularFormula | C22H19N3O2 |
| Smiles | Oc1cccc(/C=N\NC(CCn2c(cccc3)c3c3c2cccc3)=O)c1 |
| InChI | InChI=1S/C22H19N3O2/c26-17-7-5-6-16(14-17)15-23-24-22(27)12-13-25-20-10-3-1-8-18(20)19-9-2-4-11-21(19)25/h1-11,14-15,26H,12-13H2,(H,24,27) |
| InChIK | QVTDTDDAZSHGRB-UHFFFAOYSA-N |
| TotalMolweight | 357.412 |
| Molweight | 357.412 |
| MonoisotopicMass | 357.147727 |
| CLogP | 4.294 |
| CLogS | -4.851 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 279.26 |
| Relative PSA | 0.20046 |
| PolarSurfaceArea | 66.62 |
| Druglikeness | 6.0578 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55556 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 19 |
| Sp3Atoms | 3 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-carbazol-9-yl-N-[(Z)-(3-hydroxyphenyl)methylideneamino]propanamide | 2 - 3-carbazol-9-yl-N-[(Z)-(3-hydroxyphenyl)methylideneamino]propanamide