| MolName | N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]-1,3-benzothiazol-2-amine |
| MolecularFormula | C15H10N3F3S |
| Smiles | FC(c1ccc(/C=N\Nc2nc(cccc3)c3s2)cc1)(F)F |
| InChI | InChI=1S/C15H10F3N3S/c16-15(17,18)11-7-5-10(6-8-11)9-19-21-14-20-12-3-1-2-4-13(12)22-14/h1-9H,(H,20,21) |
| InChIK | QVYLJANSOBKBCU-UHFFFAOYSA-N |
| TotalMolweight | 321.325 |
| Molweight | 321.325 |
| MonoisotopicMass | 321.054751 |
| CLogP | 6.4916 |
| CLogS | -4.894 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 228 |
| Relative PSA | 0.23816 |
| PolarSurfaceArea | 65.52 |
| Druglikeness | -4.5789 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.63636 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]-1,3-benzothiazol-2-amine | 2 - N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]-1,3-benzothiazol-2-amine