| MolName | 5-[(Z)-(4-fluorophenyl)methylideneamino]-13-(furan-2-yl)-11-phenyl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
| MolecularFormula | C26H15N4O3F |
| Smiles | O=C(c(oc1c2c(-c3ccco3)cc(-c3ccccc3)n1)c2N=C1)N1/N=C\c(cc1)ccc1F |
| InChI | InChI=1S/C26H15FN4O3/c27-18-10-8-16(9-11-18)14-29-31-15-28-23-22-19(21-7-4-12-33-21)13-20(17-5-2-1-3-6-17)30-25(22)34-24(23)26(31)32/h1-15H |
| InChIK | QWAJPIYMDZOVLP-UHFFFAOYSA-N |
| TotalMolweight | 450.428 |
| Molweight | 450.428 |
| MonoisotopicMass | 450.112819 |
| CLogP | 4.9955 |
| CLogS | -8.56 |
| H Acceptors | 7 |
| TotalSurfaceArea | 335.7 |
| Relative PSA | 0.23473 |
| PolarSurfaceArea | 84.2 |
| Druglikeness | 3.0183 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.52941 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 26 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 5-[(Z)-(4-fluorophenyl)methylideneamino]-13-(furan-2-yl)-11-phenyl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one | 2 - 5-[(Z)-(4-fluorophenyl)methylideneamino]-13-(furan-2-yl)-11-phenyl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one