| MolName | [4-[(Z)-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenyl] 3-nitrobenzoate |
| MolecularFormula | C23H14N4O4Cl2S |
| Smiles | [O-][N+](c1cccc(C(Oc2ccc(/C=N\Nc3nc(-c(ccc(Cl)c4)c4Cl)cs3)cc2)=O)c1)=O |
| InChI | InChI=1S/C23H14Cl2N4O4S/c24-16-6-9-19(20(25)11-16)21-13-34-23(27-21)28-26-12-14-4-7-18(8-5-14)33-22(30)15-2-1-3-17(10-15)29(31)32/h1-13H,(H,27,28) |
| InChIK | QWBFOIHDPRGAIB-UHFFFAOYSA-N |
| TotalMolweight | 513.36 |
| Molweight | 513.36 |
| MonoisotopicMass | 512.01128 |
| CLogP | 7.7669 |
| CLogS | -8.062 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 365.72 |
| Relative PSA | 0.29465 |
| PolarSurfaceArea | 137.64 |
| Druglikeness | -1.3843 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.64706 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenyl] 3-nitrobenzoate | 2 - [4-[(Z)-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenyl] 3-nitrobenzoate