| MolName | N-[(E)-1-(1,3-benzodioxol-5-yl)-3-oxo-3-[(2Z)-2-[[5-(2,4,5-trichlorophenyl)furan-2-yl]methylidene]hydrazinyl]prop-1-en-2-yl]benzamide |
| MolecularFormula | C28H18N3O5Cl3 |
| Smiles | O=C(/C(/NC(c1ccccc1)=O)=C\c(cc1)cc2c1OCO2)N/N=C\c1ccc(-c(c(Cl)c2)cc(Cl)c2Cl)o1 |
| InChI | InChI=1S/C28H18Cl3N3O5/c29-20-13-22(31)21(30)12-19(20)24-9-7-18(39-24)14-32-34-28(36)23(33-27(35)17-4-2-1-3-5-17)10-16-6-8-25-26(11-16)38-15-37-25/h1-14H,15H2,(H,33,35)(H,34,36) |
| InChIK | QWBOVNGLICCAIT-UHFFFAOYSA-N |
| TotalMolweight | 582.826 |
| Molweight | 582.826 |
| MonoisotopicMass | 581.031203 |
| CLogP | 7.6866 |
| CLogS | -9.845 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 416.64 |
| Relative PSA | 0.2271 |
| PolarSurfaceArea | 102.16 |
| Druglikeness | 8.0243 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; polyhalo aromatic ring |
| Shape Index | 0.48718 |
| Fragments | 1 |
| Non HAtoms | 39 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(E)-1-(1,3-benzodioxol-5-yl)-3-oxo-3-[(2Z)-2-[[5-(2,4,5-trichlorophenyl)furan-2-yl]methylidene]hydrazinyl]prop-1-en-2-yl]benzamide | 2 - N-[(E)-1-(1,3-benzodioxol-5-yl)-3-oxo-3-[(2Z)-2-[[5-(2,4,5-trichlorophenyl)furan-2-yl]methylidene]hydrazinyl]prop-1-en-2-yl]benzamide