| MolName | N-[(Z)-[(Z)-2-bromo-3-phenylprop-2-enylidene]amino]-3-(4-fluorophenyl)-1H-pyrazole-5-carboxamide |
| MolecularFormula | C19H14N4OBrF |
| Smiles | O=C(c1cc(-c(cc2)ccc2F)n[nH]1)N/N=C\C(\Br)=C\c1ccccc1 |
| InChI | InChI=1S/C19H14BrFN4O/c20-15(10-13-4-2-1-3-5-13)12-22-25-19(26)18-11-17(23-24-18)14-6-8-16(21)9-7-14/h1-12H,(H,23,24)(H,25,26) |
| InChIK | QWIFAWVKGUBFEG-UHFFFAOYSA-N |
| TotalMolweight | 413.249 |
| Molweight | 413.249 |
| MonoisotopicMass | 412.0335 |
| CLogP | 3.6111 |
| CLogS | -5.535 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 284.77 |
| Relative PSA | 0.2141 |
| PolarSurfaceArea | 70.14 |
| Druglikeness | -1.0779 |
| Mutagenic | high |
| Tumorigenic | low |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.69231 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[(Z)-2-bromo-3-phenylprop-2-enylidene]amino]-3-(4-fluorophenyl)-1H-pyrazole-5-carboxamide | 2 - N-[(Z)-[(Z)-2-bromo-3-phenylprop-2-enylidene]amino]-3-(4-fluorophenyl)-1H-pyrazole-5-carboxamide