| MolName | 2-[3-[(Z)-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]indol-1-yl]-N-(4-fluorophenyl)acetamide |
| MolecularFormula | C26H20N5O2FS2 |
| Smiles | O=C(Cn1c(cccc2)c2c(/C=N\NC(CSc2nc(cccc3)c3s2)=O)c1)Nc(cc1)ccc1F |
| InChI | InChI=1S/C26H20FN5O2S2/c27-18-9-11-19(12-10-18)29-24(33)15-32-14-17(20-5-1-3-7-22(20)32)13-28-31-25(34)16-35-26-30-21-6-2-4-8-23(21)36-26/h1-14H,15-16H2,(H,29,33)(H,31,34) |
| InChIK | QWYICJZTWFMRDQ-UHFFFAOYSA-N |
| TotalMolweight | 517.608 |
| Molweight | 517.608 |
| MonoisotopicMass | 517.104243 |
| CLogP | 4.8314 |
| CLogS | -6.58 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 380.42 |
| Relative PSA | 0.30545 |
| PolarSurfaceArea | 141.92 |
| Druglikeness | 5.7467 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.61111 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-[3-[(Z)-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]indol-1-yl]-N-(4-fluorophenyl)acetamide | 2 - 2-[3-[(Z)-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]indol-1-yl]-N-(4-fluorophenyl)acetamide